C13H14ClNO4S — CID 71787723
2-chloro-N-[3-(furan-2-yl)-3-hydroxypropyl]benzenesulfonamide (PubChem CID 71787723) has the molecular formula C13H14ClNO4S and a molecular weight of 315.78 g/mol. Its IUPAC name is 2-chloro-N-[3-(furan-2-yl)-3-hydroxypropyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[3-(furan-2-yl)-3-hydroxypropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71787723 |
| Molecular Formula | C13H14ClNO4S |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 2-chloro-N-[3-(furan-2-yl)-3-hydroxypropyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCC(O)c1ccco1)c1ccccc1Cl |
| InChI | InChI=1S/C13H14ClNO4S/c14-10-4-1-2-6-13(10)20(17,18)15-8-7-11(16)12-5-3-9-19-12/h1-6,9,11,15-16H,7-8H2 |
| InChIKey | QTPQYCPAGJOIFW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |