C8H12BrNO4S — CID 90523810
1-bromo-N-[3-(furan-2-yl)-3-hydroxypropyl]methanesulfonamide (PubChem CID 90523810) has the molecular formula C8H12BrNO4S and a molecular weight of 298.16 g/mol. Its IUPAC name is 1-bromo-N-[3-(furan-2-yl)-3-hydroxypropyl]methanesulfonamide.
| Compound Name | 1-bromo-N-[3-(furan-2-yl)-3-hydroxypropyl]methanesulfonamide |
|---|---|
| PubChem CID | 90523810 |
| Molecular Formula | C8H12BrNO4S |
| Molecular Weight | 298.16 g/mol |
| Exact Mass | 296.97 |
| IUPAC Name | 1-bromo-N-[3-(furan-2-yl)-3-hydroxypropyl]methanesulfonamide |
| SMILES | O=S(=O)(CBr)NCCC(O)c1ccco1 |
| InChI | InChI=1S/C8H12BrNO4S/c9-6-15(12,13)10-4-3-7(11)8-2-1-5-14-8/h1-2,5,7,10-11H,3-4,6H2 |
| InChIKey | ZTCDRTQOKRYANW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.16 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|