C11H12ClNO4S2 — CID 90523835
5-chloro-N-[3-(furan-2-yl)-3-hydroxypropyl]thiophene-2-sulfonamide (PubChem CID 90523835) has the molecular formula C11H12ClNO4S2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 5-chloro-N-[3-(furan-2-yl)-3-hydroxypropyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[3-(furan-2-yl)-3-hydroxypropyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 90523835 |
| Molecular Formula | C11H12ClNO4S2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | 5-chloro-N-[3-(furan-2-yl)-3-hydroxypropyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCC(O)c1ccco1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H12ClNO4S2/c12-10-3-4-11(18-10)19(15,16)13-6-5-8(14)9-2-1-7-17-9/h1-4,7-8,13-14H,5-6H2 |
| InChIKey | HSLIUHWVRUASFR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |