C15H14ClNO4S2 — CID 97414328
N-[(3S)-3-(1-benzofuran-2-yl)-3-hydroxypropyl]-5-chlorothiophene-2-sulfonamide (PubChem CID 97414328) has the molecular formula C15H14ClNO4S2 and a molecular weight of 371.87 g/mol. Its IUPAC name is N-[(3S)-3-(1-benzofuran-2-yl)-3-hydroxypropyl]-5-chlorothiophene-2-sulfonamide.
| Compound Name | N-[(3S)-3-(1-benzofuran-2-yl)-3-hydroxypropyl]-5-chlorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 97414328 |
| Molecular Formula | C15H14ClNO4S2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | N-[(3S)-3-(1-benzofuran-2-yl)-3-hydroxypropyl]-5-chlorothiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCC[C@H](O)c1cc2ccccc2o1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H14ClNO4S2/c16-14-5-6-15(22-14)23(19,20)17-8-7-11(18)13-9-10-3-1-2-4-12(10)21-13/h1-6,9,11,17-18H,7-8H2/t11-/m0/s1 |
| InChIKey | LPJFBCYRZNDHAY-NSHDSACASA-N |
| XLogP | 3.55 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |