C10H12BrN3O3S — CID 122266102
1-bromo-N-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]methanesulfonamide (PubChem CID 122266102) has the molecular formula C10H12BrN3O3S and a molecular weight of 334.20 g/mol. Its IUPAC name is 1-bromo-N-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]methanesulfonamide.
| Compound Name | 1-bromo-N-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]methanesulfonamide |
|---|---|
| PubChem CID | 122266102 |
| Molecular Formula | C10H12BrN3O3S |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 1-bromo-N-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]methanesulfonamide |
| SMILES | O=S(=O)(CBr)NCC(c1ccco1)n1cccn1 |
| InChI | InChI=1S/C10H12BrN3O3S/c11-8-18(15,16)13-7-9(10-3-1-6-17-10)14-5-2-4-12-14/h1-6,9,13H,7-8H2 |
| InChIKey | BTBHYRQPZOFONQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|