C15H19N3O3 — CID 121019365
N-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]oxane-4-carboxamide (PubChem CID 121019365) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]oxane-4-carboxamide.
| Compound Name | N-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 121019365 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]oxane-4-carboxamide |
| SMILES | O=C(NCC(c1ccco1)n1cccn1)C1CCOCC1 |
| InChI | InChI=1S/C15H19N3O3/c19-15(12-4-9-20-10-5-12)16-11-13(14-3-1-8-21-14)18-7-2-6-17-18/h1-3,6-8,12-13H,4-5,9-11H2,(H,16,19) |
| InChIKey | CLXQFXXPLDBNSL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |