C16H16N4O4 — CID 122266212
N-(furan-2-ylmethyl)-N'-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]oxamide (PubChem CID 122266212) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N'-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]oxamide.
| Compound Name | N-(furan-2-ylmethyl)-N'-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]oxamide |
|---|---|
| PubChem CID | 122266212 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-N'-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]oxamide |
| SMILES | O=C(NCc1ccco1)C(=O)NCC(c1ccco1)n1cccn1 |
| InChI | InChI=1S/C16H16N4O4/c21-15(17-10-12-4-1-8-23-12)16(22)18-11-13(14-5-2-9-24-14)20-7-3-6-19-20/h1-9,13H,10-11H2,(H,17,21)(H,18,22) |
| InChIKey | GWASNTCJSLJRAD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|