C16H13F2N3O2 — CID 122265973
2,6-difluoro-N-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]benzamide (PubChem CID 122265973) has the molecular formula C16H13F2N3O2 and a molecular weight of 317.30 g/mol. Its IUPAC name is 2,6-difluoro-N-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]benzamide.
| Compound Name | 2,6-difluoro-N-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 122265973 |
| Molecular Formula | C16H13F2N3O2 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2,6-difluoro-N-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]benzamide |
| SMILES | O=C(NCC(c1ccco1)n1cccn1)c1c(F)cccc1F |
| InChI | InChI=1S/C16H13F2N3O2/c17-11-4-1-5-12(18)15(11)16(22)19-10-13(14-6-2-9-23-14)21-8-3-7-20-21/h1-9,13H,10H2,(H,19,22) |
| InChIKey | MMTIRGIOENJRBV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |