C17H15F3N4O2 — CID 122266310
1-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 122266310) has the molecular formula C17H15F3N4O2 and a molecular weight of 364.33 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 122266310 |
| Molecular Formula | C17H15F3N4O2 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 1-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCC(c1ccco1)n1cccn1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15F3N4O2/c18-17(19,20)12-4-1-5-13(10-12)23-16(25)21-11-14(15-6-2-9-26-15)24-8-3-7-22-24/h1-10,14H,11H2,(H2,21,23,25) |
| InChIKey | KMRFRZNVTYNPJL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 72.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |