C18H19N3O6S — CID 122266198
methyl 3-[[2-(furan-2-yl)-2-pyrazol-1-ylethyl]sulfamoyl]-4-methoxybenzoate (PubChem CID 122266198) has the molecular formula C18H19N3O6S and a molecular weight of 405.43 g/mol. Its IUPAC name is methyl 3-[[2-(furan-2-yl)-2-pyrazol-1-ylethyl]sulfamoyl]-4-methoxybenzoate.
| Compound Name | methyl 3-[[2-(furan-2-yl)-2-pyrazol-1-ylethyl]sulfamoyl]-4-methoxybenzoate |
|---|---|
| PubChem CID | 122266198 |
| Molecular Formula | C18H19N3O6S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | methyl 3-[[2-(furan-2-yl)-2-pyrazol-1-ylethyl]sulfamoyl]-4-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)c(S(=O)(=O)NCC(c2ccco2)n2cccn2)c1 |
| InChI | InChI=1S/C18H19N3O6S/c1-25-16-7-6-13(18(22)26-2)11-17(16)28(23,24)20-12-14(15-5-3-10-27-15)21-9-4-8-19-21/h3-11,14,20H,12H2,1-2H3 |
| InChIKey | CWWXPIYMSDLTID-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |