C16H14ClNO3S2 — CID 126850420
2-chloro-N-[2-(furan-2-yl)-2-thiophen-2-ylethyl]benzenesulfonamide (PubChem CID 126850420) has the molecular formula C16H14ClNO3S2 and a molecular weight of 367.88 g/mol. Its IUPAC name is 2-chloro-N-[2-(furan-2-yl)-2-thiophen-2-ylethyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[2-(furan-2-yl)-2-thiophen-2-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 126850420 |
| Molecular Formula | C16H14ClNO3S2 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 2-chloro-N-[2-(furan-2-yl)-2-thiophen-2-ylethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC(c1ccco1)c1cccs1)c1ccccc1Cl |
| InChI | InChI=1S/C16H14ClNO3S2/c17-13-5-1-2-8-16(13)23(19,20)18-11-12(14-6-3-9-21-14)15-7-4-10-22-15/h1-10,12,18H,11H2 |
| InChIKey | OYIBOUVEWNHALJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |