C17H17NO5S — CID 131702585
N-[2,2-bis(furan-2-yl)ethyl]-2-methoxybenzenesulfonamide (PubChem CID 131702585) has the molecular formula C17H17NO5S and a molecular weight of 347.39 g/mol. Its IUPAC name is N-[2,2-bis(furan-2-yl)ethyl]-2-methoxybenzenesulfonamide.
| Compound Name | N-[2,2-bis(furan-2-yl)ethyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 131702585 |
| Molecular Formula | C17H17NO5S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | N-[2,2-bis(furan-2-yl)ethyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccccc1S(=O)(=O)NCC(c1ccco1)c1ccco1 |
| InChI | InChI=1S/C17H17NO5S/c1-21-16-6-2-3-9-17(16)24(19,20)18-12-13(14-7-4-10-22-14)15-8-5-11-23-15/h2-11,13,18H,12H2,1H3 |
| InChIKey | YFTMQCXBJQGISO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 81.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |