C13H15NO4S — CID 99876447
N-[(2R)-2-(furan-2-yl)-2-methoxyethyl]benzenesulfonamide (PubChem CID 99876447) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is N-[(2R)-2-(furan-2-yl)-2-methoxyethyl]benzenesulfonamide.
| Compound Name | N-[(2R)-2-(furan-2-yl)-2-methoxyethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 99876447 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N-[(2R)-2-(furan-2-yl)-2-methoxyethyl]benzenesulfonamide |
| SMILES | CO[C@H](CNS(=O)(=O)c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C13H15NO4S/c1-17-13(12-8-5-9-18-12)10-14-19(15,16)11-6-3-2-4-7-11/h2-9,13-14H,10H2,1H3/t13-/m1/s1 |
| InChIKey | KXYMUFCOODOPMU-CYBMUJFWSA-N |
| XLogP | 1.95 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |