C16H20N2O5S — CID 121145655
N-[4-[[2-(furan-2-yl)-2-methoxyethyl]sulfamoyl]-3-methylphenyl]acetamide (PubChem CID 121145655) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is N-[4-[[2-(furan-2-yl)-2-methoxyethyl]sulfamoyl]-3-methylphenyl]acetamide.
| Compound Name | N-[4-[[2-(furan-2-yl)-2-methoxyethyl]sulfamoyl]-3-methylphenyl]acetamide |
|---|---|
| PubChem CID | 121145655 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | N-[4-[[2-(furan-2-yl)-2-methoxyethyl]sulfamoyl]-3-methylphenyl]acetamide |
| SMILES | COC(CNS(=O)(=O)c1ccc(NC(C)=O)cc1C)c1ccco1 |
| InChI | InChI=1S/C16H20N2O5S/c1-11-9-13(18-12(2)19)6-7-16(11)24(20,21)17-10-15(22-3)14-5-4-8-23-14/h4-9,15,17H,10H2,1-3H3,(H,18,19) |
| InChIKey | QFIALZXGLGGIGQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |