C14H17NO5S — CID 121145607
N-[2-(furan-2-yl)-2-methoxyethyl]-4-methoxybenzenesulfonamide (PubChem CID 121145607) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-methoxyethyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[2-(furan-2-yl)-2-methoxyethyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 121145607 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | N-[2-(furan-2-yl)-2-methoxyethyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(OC)c2ccco2)cc1 |
| InChI | InChI=1S/C14H17NO5S/c1-18-11-5-7-12(8-6-11)21(16,17)15-10-14(19-2)13-4-3-9-20-13/h3-9,14-15H,10H2,1-2H3 |
| InChIKey | HCYUTVLSMZRSQQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |