C18H18N2O6S — CID 131703692
5-[2,2-bis(furan-2-yl)ethylsulfamoyl]-2-methoxybenzamide (PubChem CID 131703692) has the molecular formula C18H18N2O6S and a molecular weight of 390.42 g/mol. Its IUPAC name is 5-[2,2-bis(furan-2-yl)ethylsulfamoyl]-2-methoxybenzamide.
| Compound Name | 5-[2,2-bis(furan-2-yl)ethylsulfamoyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 131703692 |
| Molecular Formula | C18H18N2O6S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 5-[2,2-bis(furan-2-yl)ethylsulfamoyl]-2-methoxybenzamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(c2ccco2)c2ccco2)cc1C(N)=O |
| InChI | InChI=1S/C18H18N2O6S/c1-24-15-7-6-12(10-13(15)18(19)21)27(22,23)20-11-14(16-4-2-8-25-16)17-5-3-9-26-17/h2-10,14,20H,11H2,1H3,(H2,19,21) |
| InChIKey | KRWHFJASPVEWPU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |