C15H17ClN2O5S2 — CID 91631065
5-[[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]sulfamoyl]-2-methoxybenzamide (PubChem CID 91631065) has the molecular formula C15H17ClN2O5S2 and a molecular weight of 404.90 g/mol. Its IUPAC name is 5-[[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]sulfamoyl]-2-methoxybenzamide.
| Compound Name | 5-[[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]sulfamoyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 91631065 |
| Molecular Formula | C15H17ClN2O5S2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 5-[[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]sulfamoyl]-2-methoxybenzamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(OC)c2ccc(Cl)s2)cc1C(N)=O |
| InChI | InChI=1S/C15H17ClN2O5S2/c1-22-11-4-3-9(7-10(11)15(17)19)25(20,21)18-8-12(23-2)13-5-6-14(16)24-13/h3-7,12,18H,8H2,1-2H3,(H2,17,19) |
| InChIKey | BGOBWELATGPYEX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |