C17H16ClNO3S2 — CID 121180263
N-[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]naphthalene-2-sulfonamide (PubChem CID 121180263) has the molecular formula C17H16ClNO3S2 and a molecular weight of 381.91 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]naphthalene-2-sulfonamide.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 121180263 |
| Molecular Formula | C17H16ClNO3S2 |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]naphthalene-2-sulfonamide |
| SMILES | COC(CNS(=O)(=O)c1ccc2ccccc2c1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C17H16ClNO3S2/c1-22-15(16-8-9-17(18)23-16)11-19-24(20,21)14-7-6-12-4-2-3-5-13(12)10-14/h2-10,15,19H,11H2,1H3 |
| InChIKey | MFZJWUHCTXVVKQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |