C14H15Cl2NO3S2 — CID 121180260
1-(2-chlorophenyl)-N-[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]methanesulfonamide (PubChem CID 121180260) has the molecular formula C14H15Cl2NO3S2 and a molecular weight of 380.32 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]methanesulfonamide.
| Compound Name | 1-(2-chlorophenyl)-N-[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]methanesulfonamide |
|---|---|
| PubChem CID | 121180260 |
| Molecular Formula | C14H15Cl2NO3S2 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[2-(5-chlorothiophen-2-yl)-2-methoxyethyl]methanesulfonamide |
| SMILES | COC(CNS(=O)(=O)Cc1ccccc1Cl)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H15Cl2NO3S2/c1-20-12(13-6-7-14(16)21-13)8-17-22(18,19)9-10-4-2-3-5-11(10)15/h2-7,12,17H,8-9H2,1H3 |
| InChIKey | YEZOEFXCSQWBEC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |