C15H18Cl2N2O2S — CID 84591502
N-(2-amino-2-phenylethyl)-1-(2-chlorophenyl)methanesulfonamide;hydrochloride (PubChem CID 84591502) has the molecular formula C15H18Cl2N2O2S and a molecular weight of 361.29 g/mol. Its IUPAC name is N-(2-amino-2-phenylethyl)-1-(2-chlorophenyl)methanesulfonamide;hydrochloride.
| Compound Name | N-(2-amino-2-phenylethyl)-1-(2-chlorophenyl)methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 84591502 |
| Molecular Formula | C15H18Cl2N2O2S |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | N-(2-amino-2-phenylethyl)-1-(2-chlorophenyl)methanesulfonamide;hydrochloride |
| SMILES | Cl.NC(CNS(=O)(=O)Cc1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C15H17ClN2O2S.ClH/c16-14-9-5-4-8-13(14)11-21(19,20)18-10-15(17)12-6-2-1-3-7-12;/h1-9,15,18H,10-11,17H2;1H |
| InChIKey | IOPVJLNOADGBRA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |