C12H22ClN3O4S2 — CID 119976308
N-(2-amino-2-phenylethyl)-2-(ethylsulfonylamino)ethanesulfonamide;hydrochloride (PubChem CID 119976308) has the molecular formula C12H22ClN3O4S2 and a molecular weight of 371.91 g/mol. Its IUPAC name is N-(2-amino-2-phenylethyl)-2-(ethylsulfonylamino)ethanesulfonamide;hydrochloride.
| Compound Name | N-(2-amino-2-phenylethyl)-2-(ethylsulfonylamino)ethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119976308 |
| Molecular Formula | C12H22ClN3O4S2 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N-(2-amino-2-phenylethyl)-2-(ethylsulfonylamino)ethanesulfonamide;hydrochloride |
| SMILES | CCS(=O)(=O)NCCS(=O)(=O)NCC(N)c1ccccc1.Cl |
| InChI | InChI=1S/C12H21N3O4S2.ClH/c1-2-20(16,17)14-8-9-21(18,19)15-10-12(13)11-6-4-3-5-7-11;/h3-7,12,14-15H,2,8-10,13H2,1H3;1H |
| InChIKey | IUXAWYFRRDGPFY-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |