C11H16ClF3N2O2S — CID 68646688
N-[2-amino-2-[2-(trifluoromethyl)phenyl]ethyl]ethanesulfonamide;hydrochloride (PubChem CID 68646688) has the molecular formula C11H16ClF3N2O2S and a molecular weight of 332.78 g/mol. Its IUPAC name is N-[2-amino-2-[2-(trifluoromethyl)phenyl]ethyl]ethanesulfonamide;hydrochloride.
| Compound Name | N-[2-amino-2-[2-(trifluoromethyl)phenyl]ethyl]ethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 68646688 |
| Molecular Formula | C11H16ClF3N2O2S |
| Molecular Weight | 332.78 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | N-[2-amino-2-[2-(trifluoromethyl)phenyl]ethyl]ethanesulfonamide;hydrochloride |
| SMILES | CCS(=O)(=O)NCC(N)c1ccccc1C(F)(F)F.Cl |
| InChI | InChI=1S/C11H15F3N2O2S.ClH/c1-2-19(17,18)16-7-10(15)8-5-3-4-6-9(8)11(12,13)14;/h3-6,10,16H,2,7,15H2,1H3;1H |
| InChIKey | ZQMHKPNRBPWLBS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.78 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |