C12H15F3N2O4S — CID 68646243
[2-(ethylsulfonylamino)-1-[2-(trifluoromethyl)phenyl]ethyl]carbamic acid (PubChem CID 68646243) has the molecular formula C12H15F3N2O4S and a molecular weight of 340.32 g/mol. Its IUPAC name is [2-(ethylsulfonylamino)-1-[2-(trifluoromethyl)phenyl]ethyl]carbamic acid.
| Compound Name | [2-(ethylsulfonylamino)-1-[2-(trifluoromethyl)phenyl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 68646243 |
| Molecular Formula | C12H15F3N2O4S |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | [2-(ethylsulfonylamino)-1-[2-(trifluoromethyl)phenyl]ethyl]carbamic acid |
| SMILES | CCS(=O)(=O)NCC(NC(=O)O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O4S/c1-2-22(20,21)16-7-10(17-11(18)19)8-5-3-4-6-9(8)12(13,14)15/h3-6,10,16-17H,2,7H2,1H3,(H,18,19) |
| InChIKey | CKWUDSBITDOISJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |