C11H11F3O2 — CID 62801818
2-[2-(trifluoromethyl)phenyl]butanoic acid (PubChem CID 62801818) has the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. Its IUPAC name is 2-[2-(trifluoromethyl)phenyl]butanoic acid.
| Compound Name | 2-[2-(trifluoromethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 62801818 |
| Molecular Formula | C11H11F3O2 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 2-[2-(trifluoromethyl)phenyl]butanoic acid |
| SMILES | CCC(C(=O)O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H11F3O2/c1-2-7(10(15)16)8-5-3-4-6-9(8)11(12,13)14/h3-7H,2H2,1H3,(H,15,16) |
| InChIKey | XRIPJECWHREVQY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |