2-[2-(trifluoromethyl)phenyl]hexanoyl chloride

C13H14ClF3O — CID 58351069

IUPAC2-[2-(trifluoromethyl)phenyl]hexanoyl chloride
SMILESCCCCC(C(=O)Cl)c1ccccc1C(F)(F)F
InChIInChI=1S/C13H14ClF3O/c1-2-3-6-10(12(14)18)9-7-4-5-8-11(9)13(15,16)17/h4-5,7-8,10H,2-3,6H2,1H3
InChIKeyBUVQBVYUNSXMKP-UHFFFAOYSA-N
MW278.70 g/mol
LogP4.74
Rot. Bonds5

About 2-[2-(trifluoromethyl)phenyl]hexanoyl chloride

2-[2-(trifluoromethyl)phenyl]hexanoyl chloride (PubChem CID 58351069) has the molecular formula C13H14ClF3O and a molecular weight of 278.70 g/mol. Its IUPAC name is 2-[2-(trifluoromethyl)phenyl]hexanoyl chloride.

Molecular Properties

Compound Name2-[2-(trifluoromethyl)phenyl]hexanoyl chloride
PubChem CID58351069
Molecular FormulaC13H14ClF3O
Molecular Weight278.70 g/mol
Exact Mass278.07
IUPAC Name2-[2-(trifluoromethyl)phenyl]hexanoyl chloride
SMILESCCCCC(C(=O)Cl)c1ccccc1C(F)(F)F
InChIInChI=1S/C13H14ClF3O/c1-2-3-6-10(12(14)18)9-7-4-5-8-11(9)13(15,16)17/h4-5,7-8,10H,2-3,6H2,1H3
InChIKeyBUVQBVYUNSXMKP-UHFFFAOYSA-N
XLogP4.74
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.70
LogP ≤ 54.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-[2-(trifluoromethyl)phenyl]hexanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(trifluoromethyl)phenyl]hexanoyl chloride?
The IUPAC name of 2-[2-(trifluoromethyl)phenyl]hexanoyl chloride (CID 58351069) is 2-[2-(trifluoromethyl)phenyl]hexanoyl chloride.
What is the SMILES notation for 2-[2-(trifluoromethyl)phenyl]hexanoyl chloride?
The canonical SMILES for 2-[2-(trifluoromethyl)phenyl]hexanoyl chloride is CCCCC(C(=O)Cl)c1ccccc1C(F)(F)F.
What is the InChIKey of 2-[2-(trifluoromethyl)phenyl]hexanoyl chloride?
The InChIKey is BUVQBVYUNSXMKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClF3O/c1-2-3-6-10(12(14)18)9-7-4-5-8-11(9)13(15,16)17/h4-5,7-8,10H,2-3,6H2,1H3.
What are the key properties of 2-[2-(trifluoromethyl)phenyl]hexanoyl chloride?
2-[2-(trifluoromethyl)phenyl]hexanoyl chloride has a molecular weight of 278.70 g/mol, XLogP of 4.74, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(trifluoromethyl)phenyl]hexanoyl chloride is sourced from PubChem (CID 58351069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).