C15H20F3NO — CID 7321292
(2S)-2-ethyl-N-[2-(trifluoromethyl)phenyl]hexanamide (PubChem CID 7321292) has the molecular formula C15H20F3NO and a molecular weight of 287.32 g/mol. Its IUPAC name is (2S)-2-ethyl-N-[2-(trifluoromethyl)phenyl]hexanamide.
| Compound Name | (2S)-2-ethyl-N-[2-(trifluoromethyl)phenyl]hexanamide |
|---|---|
| PubChem CID | 7321292 |
| Molecular Formula | C15H20F3NO |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (2S)-2-ethyl-N-[2-(trifluoromethyl)phenyl]hexanamide |
| SMILES | CCCC[C@H](CC)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H20F3NO/c1-3-5-8-11(4-2)14(20)19-13-10-7-6-9-12(13)15(16,17)18/h6-7,9-11H,3-5,8H2,1-2H3,(H,19,20)/t11-/m0/s1 |
| InChIKey | JEKYQCMOACNJEH-NSHDSACASA-N |
| XLogP | 4.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |