C25H43NO — CID 92692901
(2S,7S)-7-ethyl-N-(2-methylphenyl)-2-pentylundecanamide (PubChem CID 92692901) has the molecular formula C25H43NO and a molecular weight of 373.63 g/mol. Its IUPAC name is (2S,7S)-7-ethyl-N-(2-methylphenyl)-2-pentylundecanamide.
| Compound Name | (2S,7S)-7-ethyl-N-(2-methylphenyl)-2-pentylundecanamide |
|---|---|
| PubChem CID | 92692901 |
| Molecular Formula | C25H43NO |
| Molecular Weight | 373.63 g/mol |
| Exact Mass | 373.33 |
| IUPAC Name | (2S,7S)-7-ethyl-N-(2-methylphenyl)-2-pentylundecanamide |
| SMILES | CCCCC[C@@H](CCCC[C@@H](CC)CCCC)C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C25H43NO/c1-5-8-10-18-23(19-13-12-17-22(7-3)16-9-6-2)25(27)26-24-20-14-11-15-21(24)4/h11,14-15,20,22-23H,5-10,12-13,16-19H2,1-4H3,(H,26,27)/t22-,23-/m0/s1 |
| InChIKey | CFBARQIBIPJOKF-GOTSBHOMSA-N |
| XLogP | 7.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.63 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|