C15H23F3N2 — CID 105304814
[2-ethyl-1-[2-(trifluoromethyl)phenyl]hexyl]hydrazine (PubChem CID 105304814) has the molecular formula C15H23F3N2 and a molecular weight of 288.36 g/mol. Its IUPAC name is [2-ethyl-1-[2-(trifluoromethyl)phenyl]hexyl]hydrazine.
| Compound Name | [2-ethyl-1-[2-(trifluoromethyl)phenyl]hexyl]hydrazine |
|---|---|
| PubChem CID | 105304814 |
| Molecular Formula | C15H23F3N2 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | [2-ethyl-1-[2-(trifluoromethyl)phenyl]hexyl]hydrazine |
| SMILES | CCCCC(CC)C(NN)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H23F3N2/c1-3-5-8-11(4-2)14(20-19)12-9-6-7-10-13(12)15(16,17)18/h6-7,9-11,14,20H,3-5,8,19H2,1-2H3 |
| InChIKey | MBJJESOHWNBGDW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|