C14H14F3NO5 — CID 135580988
7,7-dihydroxy-6-nitro-5-[2-(trifluoromethyl)phenyl]hept-6-en-3-one (PubChem CID 135580988) has the molecular formula C14H14F3NO5 and a molecular weight of 333.26 g/mol. Its IUPAC name is 7,7-dihydroxy-6-nitro-5-[2-(trifluoromethyl)phenyl]hept-6-en-3-one.
| Compound Name | 7,7-dihydroxy-6-nitro-5-[2-(trifluoromethyl)phenyl]hept-6-en-3-one |
|---|---|
| PubChem CID | 135580988 |
| Molecular Formula | C14H14F3NO5 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 7,7-dihydroxy-6-nitro-5-[2-(trifluoromethyl)phenyl]hept-6-en-3-one |
| SMILES | CCC(=O)CC(C(=C(O)O)[N+](=O)[O-])c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H14F3NO5/c1-2-8(19)7-10(12(13(20)21)18(22)23)9-5-3-4-6-11(9)14(15,16)17/h3-6,10,20-21H,2,7H2,1H3 |
| InChIKey | SYNFUYCGMYEIFT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|