C14H17F3O3 — CID 62394555
ethyl 2-[hydroxy-[2-(trifluoromethyl)phenyl]methyl]butanoate (PubChem CID 62394555) has the molecular formula C14H17F3O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is ethyl 2-[hydroxy-[2-(trifluoromethyl)phenyl]methyl]butanoate.
| Compound Name | ethyl 2-[hydroxy-[2-(trifluoromethyl)phenyl]methyl]butanoate |
|---|---|
| PubChem CID | 62394555 |
| Molecular Formula | C14H17F3O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | ethyl 2-[hydroxy-[2-(trifluoromethyl)phenyl]methyl]butanoate |
| SMILES | CCOC(=O)C(CC)C(O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H17F3O3/c1-3-9(13(19)20-4-2)12(18)10-7-5-6-8-11(10)14(15,16)17/h5-9,12,18H,3-4H2,1-2H3 |
| InChIKey | FCBCBXGHKUYQNP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |