C15H13F3O2 — CID 103459409
1-phenyl-2-[2-(trifluoromethyl)phenyl]ethane-1,2-diol (PubChem CID 103459409) has the molecular formula C15H13F3O2 and a molecular weight of 282.26 g/mol. Its IUPAC name is 1-phenyl-2-[2-(trifluoromethyl)phenyl]ethane-1,2-diol.
| Compound Name | 1-phenyl-2-[2-(trifluoromethyl)phenyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 103459409 |
| Molecular Formula | C15H13F3O2 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 1-phenyl-2-[2-(trifluoromethyl)phenyl]ethane-1,2-diol |
| SMILES | OC(c1ccccc1)C(O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H13F3O2/c16-15(17,18)12-9-5-4-8-11(12)14(20)13(19)10-6-2-1-3-7-10/h1-9,13-14,19-20H |
| InChIKey | KCFNWENXENPTKQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |