C11H10F3NO2 — CID 171901212
3,4-dihydroxy-4-[2-(trifluoromethyl)phenyl]butanenitrile (PubChem CID 171901212) has the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. Its IUPAC name is 3,4-dihydroxy-4-[2-(trifluoromethyl)phenyl]butanenitrile.
| Compound Name | 3,4-dihydroxy-4-[2-(trifluoromethyl)phenyl]butanenitrile |
|---|---|
| PubChem CID | 171901212 |
| Molecular Formula | C11H10F3NO2 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 3,4-dihydroxy-4-[2-(trifluoromethyl)phenyl]butanenitrile |
| SMILES | N#CCC(O)C(O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H10F3NO2/c12-11(13,14)8-4-2-1-3-7(8)10(17)9(16)5-6-15/h1-4,9-10,16-17H,5H2 |
| InChIKey | VFJNFFSOTHLXEP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |