C18H15NO2 — CID 171901989
3,4-dihydroxy-4-phenanthren-9-ylbutanenitrile (PubChem CID 171901989) has the molecular formula C18H15NO2 and a molecular weight of 277.32 g/mol. Its IUPAC name is 3,4-dihydroxy-4-phenanthren-9-ylbutanenitrile.
| Compound Name | 3,4-dihydroxy-4-phenanthren-9-ylbutanenitrile |
|---|---|
| PubChem CID | 171901989 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 3,4-dihydroxy-4-phenanthren-9-ylbutanenitrile |
| SMILES | N#CCC(O)C(O)c1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C18H15NO2/c19-10-9-17(20)18(21)16-11-12-5-1-2-6-13(12)14-7-3-4-8-15(14)16/h1-8,11,17-18,20-21H,9H2 |
| InChIKey | LBUZZIITRPWLCE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|