C10H9Br2NO2 — CID 171902047
4-(2,5-dibromophenyl)-3,4-dihydroxybutanenitrile (PubChem CID 171902047) has the molecular formula C10H9Br2NO2 and a molecular weight of 335.00 g/mol. Its IUPAC name is 4-(2,5-dibromophenyl)-3,4-dihydroxybutanenitrile.
| Compound Name | 4-(2,5-dibromophenyl)-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171902047 |
| Molecular Formula | C10H9Br2NO2 |
| Molecular Weight | 335.00 g/mol |
| Exact Mass | 332.90 |
| IUPAC Name | 4-(2,5-dibromophenyl)-3,4-dihydroxybutanenitrile |
| SMILES | N#CCC(O)C(O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C10H9Br2NO2/c11-6-1-2-8(12)7(5-6)10(15)9(14)3-4-13/h1-2,5,9-10,14-15H,3H2 |
| InChIKey | OWAAJZGXYQHLSN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.00 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |