C12H12N2O3 — CID 171901456
3-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzonitrile (PubChem CID 171901456) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 3-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzonitrile.
| Compound Name | 3-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzonitrile |
|---|---|
| PubChem CID | 171901456 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 3-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzonitrile |
| SMILES | COc1ccc(C#N)cc1C(O)C(O)CC#N |
| InChI | InChI=1S/C12H12N2O3/c1-17-11-3-2-8(7-14)6-9(11)12(16)10(15)4-5-13/h2-3,6,10,12,15-16H,4H2,1H3 |
| InChIKey | JDXVDFIMEBPVQI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |