C12H14BrNO4 — CID 171892691
3-(4-bromo-1,2-dihydroxybutyl)-4-hydroxy-5-methoxybenzonitrile (PubChem CID 171892691) has the molecular formula C12H14BrNO4 and a molecular weight of 316.15 g/mol. Its IUPAC name is 3-(4-bromo-1,2-dihydroxybutyl)-4-hydroxy-5-methoxybenzonitrile.
| Compound Name | 3-(4-bromo-1,2-dihydroxybutyl)-4-hydroxy-5-methoxybenzonitrile |
|---|---|
| PubChem CID | 171892691 |
| Molecular Formula | C12H14BrNO4 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 3-(4-bromo-1,2-dihydroxybutyl)-4-hydroxy-5-methoxybenzonitrile |
| SMILES | COc1cc(C#N)cc(C(O)C(O)CCBr)c1O |
| InChI | InChI=1S/C12H14BrNO4/c1-18-10-5-7(6-14)4-8(12(10)17)11(16)9(15)2-3-13/h4-5,9,11,15-17H,2-3H2,1H3 |
| InChIKey | IEQRUBSALXSUNC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|