C11H13NO4 — CID 170818330
4-methoxy-3-(1,2,3-trihydroxypropyl)benzonitrile (PubChem CID 170818330) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is 4-methoxy-3-(1,2,3-trihydroxypropyl)benzonitrile.
| Compound Name | 4-methoxy-3-(1,2,3-trihydroxypropyl)benzonitrile |
|---|---|
| PubChem CID | 170818330 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 4-methoxy-3-(1,2,3-trihydroxypropyl)benzonitrile |
| SMILES | COc1ccc(C#N)cc1C(O)C(O)CO |
| InChI | InChI=1S/C11H13NO4/c1-16-10-3-2-7(5-12)4-8(10)11(15)9(14)6-13/h2-4,9,11,13-15H,6H2,1H3 |
| InChIKey | UJFMVGBWEVMVNC-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |