C11H13NO3 — CID 170817915
3-methyl-4-(1,2,3-trihydroxypropyl)benzonitrile (PubChem CID 170817915) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 3-methyl-4-(1,2,3-trihydroxypropyl)benzonitrile.
| Compound Name | 3-methyl-4-(1,2,3-trihydroxypropyl)benzonitrile |
|---|---|
| PubChem CID | 170817915 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 3-methyl-4-(1,2,3-trihydroxypropyl)benzonitrile |
| SMILES | Cc1cc(C#N)ccc1C(O)C(O)CO |
| InChI | InChI=1S/C11H13NO3/c1-7-4-8(5-12)2-3-9(7)11(15)10(14)6-13/h2-4,10-11,13-15H,6H2,1H3 |
| InChIKey | XYZVWGLISOBMRT-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |