C11H11ClFNO2 — CID 171893826
4-(4-chloro-1,2-dihydroxybutyl)-3-fluorobenzonitrile (PubChem CID 171893826) has the molecular formula C11H11ClFNO2 and a molecular weight of 243.66 g/mol. Its IUPAC name is 4-(4-chloro-1,2-dihydroxybutyl)-3-fluorobenzonitrile.
| Compound Name | 4-(4-chloro-1,2-dihydroxybutyl)-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 171893826 |
| Molecular Formula | C11H11ClFNO2 |
| Molecular Weight | 243.66 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 4-(4-chloro-1,2-dihydroxybutyl)-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(C(O)C(O)CCCl)c(F)c1 |
| InChI | InChI=1S/C11H11ClFNO2/c12-4-3-10(15)11(16)8-2-1-7(6-14)5-9(8)13/h1-2,5,10-11,15-16H,3-4H2 |
| InChIKey | ZHTGVGMRDWXLSS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.66 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|