C12H15ClN2O2 — CID 171890237
3-chloro-4-[1,2-dihydroxy-4-(methylamino)butyl]benzonitrile (PubChem CID 171890237) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 3-chloro-4-[1,2-dihydroxy-4-(methylamino)butyl]benzonitrile.
| Compound Name | 3-chloro-4-[1,2-dihydroxy-4-(methylamino)butyl]benzonitrile |
|---|---|
| PubChem CID | 171890237 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 3-chloro-4-[1,2-dihydroxy-4-(methylamino)butyl]benzonitrile |
| SMILES | CNCCC(O)C(O)c1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C12H15ClN2O2/c1-15-5-4-11(16)12(17)9-3-2-8(7-14)6-10(9)13/h2-3,6,11-12,15-17H,4-5H2,1H3 |
| InChIKey | YWDVCMJFCZRBNO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |