C11H15BrClNO2 — CID 171891291
1-(5-bromo-2-chlorophenyl)-4-(methylamino)butane-1,2-diol (PubChem CID 171891291) has the molecular formula C11H15BrClNO2 and a molecular weight of 308.60 g/mol. Its IUPAC name is 1-(5-bromo-2-chlorophenyl)-4-(methylamino)butane-1,2-diol.
| Compound Name | 1-(5-bromo-2-chlorophenyl)-4-(methylamino)butane-1,2-diol |
|---|---|
| PubChem CID | 171891291 |
| Molecular Formula | C11H15BrClNO2 |
| Molecular Weight | 308.60 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 1-(5-bromo-2-chlorophenyl)-4-(methylamino)butane-1,2-diol |
| SMILES | CNCCC(O)C(O)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C11H15BrClNO2/c1-14-5-4-10(15)11(16)8-6-7(12)2-3-9(8)13/h2-3,6,10-11,14-16H,4-5H2,1H3 |
| InChIKey | SBKGNUWDAYNCOI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.60 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |