C12H16BrN3O2 — CID 171891347
1-(6-bromo-2H-indazol-3-yl)-4-(methylamino)butane-1,2-diol (PubChem CID 171891347) has the molecular formula C12H16BrN3O2 and a molecular weight of 314.18 g/mol. Its IUPAC name is 1-(6-bromo-2H-indazol-3-yl)-4-(methylamino)butane-1,2-diol.
| Compound Name | 1-(6-bromo-2H-indazol-3-yl)-4-(methylamino)butane-1,2-diol |
|---|---|
| PubChem CID | 171891347 |
| Molecular Formula | C12H16BrN3O2 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 1-(6-bromo-2H-indazol-3-yl)-4-(methylamino)butane-1,2-diol |
| SMILES | CNCCC(O)C(O)c1[nH]nc2cc(Br)ccc12 |
| InChI | InChI=1S/C12H16BrN3O2/c1-14-5-4-10(17)12(18)11-8-3-2-7(13)6-9(8)15-16-11/h2-3,6,10,12,14,17-18H,4-5H2,1H3,(H,15,16) |
| InChIKey | GXGIDOZFEPVHTH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |