C11H14Cl3NO2 — CID 171890030
4-(methylamino)-1-(2,4,5-trichlorophenyl)butane-1,2-diol (PubChem CID 171890030) has the molecular formula C11H14Cl3NO2 and a molecular weight of 298.60 g/mol. Its IUPAC name is 4-(methylamino)-1-(2,4,5-trichlorophenyl)butane-1,2-diol.
| Compound Name | 4-(methylamino)-1-(2,4,5-trichlorophenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171890030 |
| Molecular Formula | C11H14Cl3NO2 |
| Molecular Weight | 298.60 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 4-(methylamino)-1-(2,4,5-trichlorophenyl)butane-1,2-diol |
| SMILES | CNCCC(O)C(O)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl3NO2/c1-15-3-2-10(16)11(17)6-4-8(13)9(14)5-7(6)12/h4-5,10-11,15-17H,2-3H2,1H3 |
| InChIKey | COVJACUYFFGOFN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.60 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|