C11H14ClF2NO2 — CID 171890043
1-(4-chloro-3,5-difluorophenyl)-4-(methylamino)butane-1,2-diol (PubChem CID 171890043) has the molecular formula C11H14ClF2NO2 and a molecular weight of 265.69 g/mol. Its IUPAC name is 1-(4-chloro-3,5-difluorophenyl)-4-(methylamino)butane-1,2-diol.
| Compound Name | 1-(4-chloro-3,5-difluorophenyl)-4-(methylamino)butane-1,2-diol |
|---|---|
| PubChem CID | 171890043 |
| Molecular Formula | C11H14ClF2NO2 |
| Molecular Weight | 265.69 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 1-(4-chloro-3,5-difluorophenyl)-4-(methylamino)butane-1,2-diol |
| SMILES | CNCCC(O)C(O)c1cc(F)c(Cl)c(F)c1 |
| InChI | InChI=1S/C11H14ClF2NO2/c1-15-3-2-9(16)11(17)6-4-7(13)10(12)8(14)5-6/h4-5,9,11,15-17H,2-3H2,1H3 |
| InChIKey | PWVVZEOZIJQNCX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.69 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|