C10H10ClF2N3O2 — CID 171879291
4-azido-1-(4-chloro-3,5-difluorophenyl)butane-1,2-diol (PubChem CID 171879291) has the molecular formula C10H10ClF2N3O2 and a molecular weight of 277.66 g/mol. Its IUPAC name is 4-azido-1-(4-chloro-3,5-difluorophenyl)butane-1,2-diol.
| Compound Name | 4-azido-1-(4-chloro-3,5-difluorophenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171879291 |
| Molecular Formula | C10H10ClF2N3O2 |
| Molecular Weight | 277.66 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 4-azido-1-(4-chloro-3,5-difluorophenyl)butane-1,2-diol |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1cc(F)c(Cl)c(F)c1 |
| InChI | InChI=1S/C10H10ClF2N3O2/c11-9-6(12)3-5(4-7(9)13)10(18)8(17)1-2-15-16-14/h3-4,8,10,17-18H,1-2H2 |
| InChIKey | ASGSUKUVOIVOGR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.66 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|