C8H10FN5O2 — CID 171878905
4-azido-1-(2-fluoropyrimidin-5-yl)butane-1,2-diol (PubChem CID 171878905) has the molecular formula C8H10FN5O2 and a molecular weight of 227.20 g/mol. Its IUPAC name is 4-azido-1-(2-fluoropyrimidin-5-yl)butane-1,2-diol.
| Compound Name | 4-azido-1-(2-fluoropyrimidin-5-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 171878905 |
| Molecular Formula | C8H10FN5O2 |
| Molecular Weight | 227.20 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 4-azido-1-(2-fluoropyrimidin-5-yl)butane-1,2-diol |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1cnc(F)nc1 |
| InChI | InChI=1S/C8H10FN5O2/c9-8-11-3-5(4-12-8)7(16)6(15)1-2-13-14-10/h3-4,6-7,15-16H,1-2H2 |
| InChIKey | LPKWOFHNMZFLQN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.20 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|