C9H12N4O3 — CID 171878967
4-azido-1-(5-hydroxy-3-pyridinyl)butane-1,2-diol (PubChem CID 171878967) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 4-azido-1-(5-hydroxy-3-pyridinyl)butane-1,2-diol.
| Compound Name | 4-azido-1-(5-hydroxy-3-pyridinyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171878967 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 4-azido-1-(5-hydroxy-3-pyridinyl)butane-1,2-diol |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1cncc(O)c1 |
| InChI | InChI=1S/C9H12N4O3/c10-13-12-2-1-8(15)9(16)6-3-7(14)5-11-4-6/h3-5,8-9,14-16H,1-2H2 |
| InChIKey | KQMRJGIIWSJYNC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|