C7H11N5O2 — CID 171878849
4-azido-1-(1H-pyrazol-4-yl)butane-1,2-diol (PubChem CID 171878849) has the molecular formula C7H11N5O2 and a molecular weight of 197.20 g/mol. Its IUPAC name is 4-azido-1-(1H-pyrazol-4-yl)butane-1,2-diol.
| Compound Name | 4-azido-1-(1H-pyrazol-4-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 171878849 |
| Molecular Formula | C7H11N5O2 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 4-azido-1-(1H-pyrazol-4-yl)butane-1,2-diol |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1cn[nH]c1 |
| InChI | InChI=1S/C7H11N5O2/c8-12-9-2-1-6(13)7(14)5-3-10-11-4-5/h3-4,6-7,13-14H,1-2H2,(H,10,11) |
| InChIKey | VCAHAHKPDBBOGJ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 117.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|