C10H13N3O2S — CID 171878886
4-azido-1-(4-sulfanylphenyl)butane-1,2-diol (PubChem CID 171878886) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 4-azido-1-(4-sulfanylphenyl)butane-1,2-diol.
| Compound Name | 4-azido-1-(4-sulfanylphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171878886 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 4-azido-1-(4-sulfanylphenyl)butane-1,2-diol |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1ccc(S)cc1 |
| InChI | InChI=1S/C10H13N3O2S/c11-13-12-6-5-9(14)10(15)7-1-3-8(16)4-2-7/h1-4,9-10,14-16H,5-6H2 |
| InChIKey | PWTKPVLKLSMJTK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|