C12H16N4O3 — CID 171879950
1-[2-amino-5-(4-azido-1,2-dihydroxybutyl)phenyl]ethanone (PubChem CID 171879950) has the molecular formula C12H16N4O3 and a molecular weight of 264.29 g/mol. Its IUPAC name is 1-[2-amino-5-(4-azido-1,2-dihydroxybutyl)phenyl]ethanone.
| Compound Name | 1-[2-amino-5-(4-azido-1,2-dihydroxybutyl)phenyl]ethanone |
|---|---|
| PubChem CID | 171879950 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-[2-amino-5-(4-azido-1,2-dihydroxybutyl)phenyl]ethanone |
| SMILES | CC(=O)c1cc(C(O)C(O)CCN=[N+]=[N-])ccc1N |
| InChI | InChI=1S/C12H16N4O3/c1-7(17)9-6-8(2-3-10(9)13)12(19)11(18)4-5-15-16-14/h2-3,6,11-12,18-19H,4-5,13H2,1H3 |
| InChIKey | NYMJWTQVUWFDTE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 132.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|